ChemNet > CAS > 58327-75-6 3-aminothieno[2,3-b]pyridine-2-carboxylic acid
58327-75-6 3-aminothieno[2,3-b]pyridine-2-carboxylic acid
اسم المنتج |
3-aminothieno[2,3-b]pyridine-2-carboxylic acid |
الاسم المستعار |
3-Aminothieno(2,3-b)pyridine-2-carboxylic acid; NSC 284503 |
الصيغة الجزيئية |
C8H6N2O2S |
الوزن الجزيئي الغرامي |
194.2104 |
InChI |
InChI=1/C8H6N2O2S/c9-5-4-2-1-3-10-7(4)13-6(5)8(11)12/h1-3H,9H2,(H,11,12) |
إستراتيجية المساعدة القطرية |
58327-75-6 |
بنية جزيئية |
|
كثافة |
1.604g/cm3 |
درجة الإنصهار |
278℃ |
نقطة الغليان |
453.3°C at 760 mmHg |
معامل الإنكسار |
1.799 |
نقطة الوميض |
228°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|